C13H11Br2NOS — CID 43227438
1-(2,5-dibromothiophen-3-yl)-2-(N-methylanilino)ethanone (PubChem CID 43227438) has the molecular formula C13H11Br2NOS and a molecular weight of 389.11 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(N-methylanilino)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(N-methylanilino)ethanone |
|---|---|
| PubChem CID | 43227438 |
| Molecular Formula | C13H11Br2NOS |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 386.89 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(N-methylanilino)ethanone |
| SMILES | CN(CC(=O)c1cc(Br)sc1Br)c1ccccc1 |
| InChI | InChI=1S/C13H11Br2NOS/c1-16(9-5-3-2-4-6-9)8-11(17)10-7-12(14)18-13(10)15/h2-7H,8H2,1H3 |
| InChIKey | KNJCDKRDGQULDH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |