About 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one
5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one (PubChem CID 43228610) has the molecular formula C13H18BrN3O
and a molecular weight of 312.21 g/mol. Its IUPAC name is 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 43228610 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCCCCCNc1cc2[nH]c(=O)[nH]c2cc1Br |
| InChI | InChI=1S/C13H18BrN3O/c1-2-3-4-5-6-15-10-8-12-11(7-9(10)14)16-13(18)17-12/h7-8,15H,2-6H2,1H3,(H2,16,17,18) |
| InChIKey | UZSMZJFQJZUOHA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one (CID 43228610) is 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one is CCCCCCNc1cc2[nH]c(=O)[nH]c2cc1Br.
What is the InChIKey of 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one?
The InChIKey is UZSMZJFQJZUOHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrN3O/c1-2-3-4-5-6-15-10-8-12-11(7-9(10)14)16-13(18)17-12/h7-8,15H,2-6H2,1H3,(H2,16,17,18).
What are the key properties of 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one?
5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one has a molecular weight of 312.21 g/mol, XLogP of 3.61, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-(hexylamino)-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 43228610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).