C15H11F2NO2 — CID 43231298
4-[(2,3-difluorophenyl)methoxy]-3-methoxybenzonitrile (PubChem CID 43231298) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[(2,3-difluorophenyl)methoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 43231298 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCc1cccc(F)c1F |
| InChI | InChI=1S/C15H11F2NO2/c1-19-14-7-10(8-18)5-6-13(14)20-9-11-3-2-4-12(16)15(11)17/h2-7H,9H2,1H3 |
| InChIKey | QDOOIZAZPQQACX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |