About 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol
3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol (PubChem CID 43232887) has the molecular formula C12H16FNOS
and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol |
| PubChem CID | 43232887 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol |
| SMILES | OCCCNC1CCSc2c(F)cccc21 |
| InChI | InChI=1S/C12H16FNOS/c13-10-4-1-3-9-11(14-6-2-7-15)5-8-16-12(9)10/h1,3-4,11,14-15H,2,5-8H2 |
| InChIKey | SLIYDJSQPQBGAL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol?
The IUPAC name of 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol (CID 43232887) is 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol is OCCCNC1CCSc2c(F)cccc21.
What is the InChIKey of 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol?
The InChIKey is SLIYDJSQPQBGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNOS/c13-10-4-1-3-9-11(14-6-2-7-15)5-8-16-12(9)10/h1,3-4,11,14-15H,2,5-8H2.
What are the key properties of 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol?
3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol has a molecular weight of 241.33 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]propan-1-ol is sourced from PubChem (CID 43232887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).