C15H14BrClFNO2 — CID 43233998
N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxyaniline (PubChem CID 43233998) has the molecular formula C15H14BrClFNO2 and a molecular weight of 374.64 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxyaniline.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 43233998 |
| Molecular Formula | C15H14BrClFNO2 |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxyaniline |
| SMILES | COc1cc(Cl)c(NCc2ccc(Br)cc2F)cc1OC |
| InChI | InChI=1S/C15H14BrClFNO2/c1-20-14-6-11(17)13(7-15(14)21-2)19-8-9-3-4-10(16)5-12(9)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | ICOWRJGNTWSILT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|