About 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one
3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one (PubChem CID 43234796) has the molecular formula C14H18Cl2N2O
and a molecular weight of 301.22 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one.
Molecular Properties
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one |
| PubChem CID | 43234796 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one |
| SMILES | CC(NC1CCCCNC1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9(10-5-6-11(15)12(16)8-10)18-13-4-2-3-7-17-14(13)19/h5-6,8-9,13,18H,2-4,7H2,1H3,(H,17,19) |
| InChIKey | LKDQDHYNJQUIAL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one?
The IUPAC name of 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one (CID 43234796) is 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one.
What is the SMILES notation for 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one?
The canonical SMILES for 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one is CC(NC1CCCCNC1=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one?
The InChIKey is LKDQDHYNJQUIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O/c1-9(10-5-6-11(15)12(16)8-10)18-13-4-2-3-7-17-14(13)19/h5-6,8-9,13,18H,2-4,7H2,1H3,(H,17,19).
What are the key properties of 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one?
3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one has a molecular weight of 301.22 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one is sourced from PubChem (CID 43234796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).