C14H18Cl2N2O — CID 43234796
3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one (PubChem CID 43234796) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one.
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one |
|---|---|
| PubChem CID | 43234796 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylamino]azepan-2-one |
| SMILES | CC(NC1CCCCNC1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9(10-5-6-11(15)12(16)8-10)18-13-4-2-3-7-17-14(13)19/h5-6,8-9,13,18H,2-4,7H2,1H3,(H,17,19) |
| InChIKey | LKDQDHYNJQUIAL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |