C13H23NO2 — CID 43235135
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanoic acid (PubChem CID 43235135) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanoic acid.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 43235135 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C13H23NO2/c1-2-12(13(15)16)14-8-7-10-5-3-4-6-11(10)9-14/h10-12H,2-9H2,1H3,(H,15,16) |
| InChIKey | SHKOKZAEDCGNCV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |