C14H10F2O2S — CID 43236037
2-(2,5-difluorophenyl)sulfanyl-2-phenylacetic acid (PubChem CID 43236037) has the molecular formula C14H10F2O2S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanyl-2-phenylacetic acid.
| Compound Name | 2-(2,5-difluorophenyl)sulfanyl-2-phenylacetic acid |
|---|---|
| PubChem CID | 43236037 |
| Molecular Formula | C14H10F2O2S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfanyl-2-phenylacetic acid |
| SMILES | O=C(O)C(Sc1cc(F)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C14H10F2O2S/c15-10-6-7-11(16)12(8-10)19-13(14(17)18)9-4-2-1-3-5-9/h1-8,13H,(H,17,18) |
| InChIKey | NCFXQYTZUMZZCR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |