About 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide
1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 43237179) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide |
| PubChem CID | 43237179 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c2sc(C(N)=O)cc12 |
| InChI | InChI=1S/C8H9N3OS/c1-4-5-3-6(7(9)12)13-8(5)11(2)10-4/h3H,1-2H3,(H2,9,12) |
| InChIKey | GGDSNCJKPWDFQP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide?
The IUPAC name of 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide (CID 43237179) is 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide.
What is the SMILES notation for 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide?
The canonical SMILES for 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide is Cc1nn(C)c2sc(C(N)=O)cc12.
What is the InChIKey of 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide?
The InChIKey is GGDSNCJKPWDFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-4-5-3-6(7(9)12)13-8(5)11(2)10-4/h3H,1-2H3,(H2,9,12).
What are the key properties of 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide?
1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide has a molecular weight of 195.25 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide is sourced from PubChem (CID 43237179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).