C13H7Cl3N2O3 — CID 43238498
4-[(3,4,5-trichloropyridine-2-carbonyl)amino]benzoic acid (PubChem CID 43238498) has the molecular formula C13H7Cl3N2O3 and a molecular weight of 345.57 g/mol. Its IUPAC name is 4-[(3,4,5-trichloropyridine-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(3,4,5-trichloropyridine-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 43238498 |
| Molecular Formula | C13H7Cl3N2O3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 4-[(3,4,5-trichloropyridine-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ncc(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C13H7Cl3N2O3/c14-8-5-17-11(10(16)9(8)15)12(19)18-7-3-1-6(2-4-7)13(20)21/h1-5H,(H,18,19)(H,20,21) |
| InChIKey | XNLNIVOUVISWTC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |