C14H15Cl2NO3S — CID 43238687
2-[[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 43238687) has the molecular formula C14H15Cl2NO3S and a molecular weight of 348.25 g/mol. Its IUPAC name is 2-[[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43238687 |
| Molecular Formula | C14H15Cl2NO3S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2-[[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)/C=C/c1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H15Cl2NO3S/c1-21-8-7-12(14(19)20)17-13(18)6-5-9-10(15)3-2-4-11(9)16/h2-6,12H,7-8H2,1H3,(H,17,18)(H,19,20)/b6-5+ |
| InChIKey | YZIRIAJMCAZISN-AATRIKPKSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|