C13H17NO6 — CID 43238739
3-hydroxy-2-[[2-(2-methoxyphenoxy)acetyl]amino]butanoic acid (PubChem CID 43238739) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(2-methoxyphenoxy)acetyl]amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[[2-(2-methoxyphenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43238739 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-hydroxy-2-[[2-(2-methoxyphenoxy)acetyl]amino]butanoic acid |
| SMILES | COc1ccccc1OCC(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C13H17NO6/c1-8(15)12(13(17)18)14-11(16)7-20-10-6-4-3-5-9(10)19-2/h3-6,8,12,15H,7H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | SMLFPWKMISVKCG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |