C14H15Cl2NO3 — CID 43239840
1-[2-(2,6-dichlorophenyl)acetyl]piperidine-2-carboxylic acid (PubChem CID 43239840) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)acetyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(2,6-dichlorophenyl)acetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43239840 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)acetyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H15Cl2NO3/c15-10-4-3-5-11(16)9(10)8-13(18)17-7-2-1-6-12(17)14(19)20/h3-5,12H,1-2,6-8H2,(H,19,20) |
| InChIKey | CRCWZXZETQPXHI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |