C12H15NO4 — CID 43241710
2-[[2-(2-methoxy-5-methylphenyl)acetyl]amino]acetic acid (PubChem CID 43241710) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[[2-(2-methoxy-5-methylphenyl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-methoxy-5-methylphenyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 43241710 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[[2-(2-methoxy-5-methylphenyl)acetyl]amino]acetic acid |
| SMILES | COc1ccc(C)cc1CC(=O)NCC(=O)O |
| InChI | InChI=1S/C12H15NO4/c1-8-3-4-10(17-2)9(5-8)6-11(14)13-7-12(15)16/h3-5H,6-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | COXJRDUQDZWIOQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |