C8H13N3 — CID 43243410
1-methyl-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 43243410) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-methyl-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 1-methyl-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 43243410 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-methyl-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | Cn1ncc2c1CCCC2N |
| InChI | InChI=1S/C8H13N3/c1-11-8-4-2-3-7(9)6(8)5-10-11/h5,7H,2-4,9H2,1H3 |
| InChIKey | QDECMLXPLVRYBO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |