C18H19NO2 — CID 43243687
2-[4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]acetonitrile (PubChem CID 43243687) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 43243687 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]acetonitrile |
| SMILES | Cc1cc(C)cc(OCCOc2ccc(CC#N)cc2)c1 |
| InChI | InChI=1S/C18H19NO2/c1-14-11-15(2)13-18(12-14)21-10-9-20-17-5-3-16(4-6-17)7-8-19/h3-6,11-13H,7,9-10H2,1-2H3 |
| InChIKey | QCJDRRKORFEFDG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|