C13H13FN2O — CID 43243930
4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile (PubChem CID 43243930) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile.
| Compound Name | 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 43243930 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile |
| SMILES | N#CCCCN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H13FN2O/c14-11-5-3-10-4-6-13(17)16(12(10)9-11)8-2-1-7-15/h3,5,9H,1-2,4,6,8H2 |
| InChIKey | UGMKFSMPYLHGBD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|