About 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide
4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide (PubChem CID 43243934) has the molecular formula C13H15FN2OS
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide.
Molecular Properties
| Compound Name | 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide |
| PubChem CID | 43243934 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide |
| SMILES | NC(=S)CCCN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H15FN2OS/c14-10-5-3-9-4-6-13(17)16(11(9)8-10)7-1-2-12(15)18/h3,5,8H,1-2,4,6-7H2,(H2,15,18) |
| InChIKey | LKXAAIFXMQHAQB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide?
The IUPAC name of 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide (CID 43243934) is 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide.
What is the SMILES notation for 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide?
The canonical SMILES for 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide is NC(=S)CCCN1C(=O)CCc2ccc(F)cc21.
What is the InChIKey of 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide?
The InChIKey is LKXAAIFXMQHAQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2OS/c14-10-5-3-9-4-6-13(17)16(11(9)8-10)7-1-2-12(15)18/h3,5,8H,1-2,4,6-7H2,(H2,15,18).
What are the key properties of 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide?
4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide has a molecular weight of 266.34 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide is sourced from PubChem (CID 43243934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).