About 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 43244742) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
| PubChem CID | 43244742 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | NC(=O)Cc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C9H8N2O2S/c10-8(12)4-6-5-14-9(11-6)7-2-1-3-13-7/h1-3,5H,4H2,(H2,10,12) |
| InChIKey | UFGFDBFEPNOWMT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide?
The IUPAC name of 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide (CID 43244742) is 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide.
What is the SMILES notation for 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide?
The canonical SMILES for 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide is NC(=O)Cc1csc(-c2ccco2)n1.
What is the InChIKey of 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide?
The InChIKey is UFGFDBFEPNOWMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c10-8(12)4-6-5-14-9(11-6)7-2-1-3-13-7/h1-3,5H,4H2,(H2,10,12).
What are the key properties of 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide?
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide has a molecular weight of 208.24 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide is sourced from PubChem (CID 43244742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).