About 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide (PubChem CID 43244797) has the molecular formula C8H13N3OS2
and a molecular weight of 231.35 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide |
| PubChem CID | 43244797 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide |
| SMILES | Cc1nc(CSCCC(=O)NN)cs1 |
| InChI | InChI=1S/C8H13N3OS2/c1-6-10-7(5-14-6)4-13-3-2-8(12)11-9/h5H,2-4,9H2,1H3,(H,11,12) |
| InChIKey | WRJZQGGZHNZFDN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide (CID 43244797) is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide is Cc1nc(CSCCC(=O)NN)cs1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide?
The InChIKey is WRJZQGGZHNZFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS2/c1-6-10-7(5-14-6)4-13-3-2-8(12)11-9/h5H,2-4,9H2,1H3,(H,11,12).
What are the key properties of 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide?
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide has a molecular weight of 231.35 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanehydrazide is sourced from PubChem (CID 43244797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).