About 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid
1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 43245285) has the molecular formula C13H18N2O4S
and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 43245285 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1csc(=O)n1CC(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H18N2O4S/c1-9-8-20-12(19)15(9)7-10(16)14-13(11(17)18)5-3-2-4-6-13/h8H,2-7H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | DYRSJHUNNHQXHK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid (CID 43245285) is 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid is Cc1csc(=O)n1CC(=O)NC1(C(=O)O)CCCCC1.
What is the InChIKey of 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The InChIKey is DYRSJHUNNHQXHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4S/c1-9-8-20-12(19)15(9)7-10(16)14-13(11(17)18)5-3-2-4-6-13/h8H,2-7H2,1H3,(H,14,16)(H,17,18).
What are the key properties of 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid has a molecular weight of 298.36 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 43245285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).