About 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride
2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride (PubChem CID 43246993) has the molecular formula C9H7ClF3NO5S
and a molecular weight of 333.67 g/mol. Its IUPAC name is 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride |
| PubChem CID | 43246993 |
| Molecular Formula | C9H7ClF3NO5S |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(OCC(F)(F)F)c([N+](=O)[O-])cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H7ClF3NO5S/c1-5-2-7(19-4-9(11,12)13)6(14(15)16)3-8(5)20(10,17)18/h2-3H,4H2,1H3 |
| InChIKey | GGEHOZJDQIWVGZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride?
The IUPAC name of 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride (CID 43246993) is 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride.
What is the SMILES notation for 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride?
The canonical SMILES for 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride is Cc1cc(OCC(F)(F)F)c([N+](=O)[O-])cc1S(=O)(=O)Cl.
What is the InChIKey of 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride?
The InChIKey is GGEHOZJDQIWVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF3NO5S/c1-5-2-7(19-4-9(11,12)13)6(14(15)16)3-8(5)20(10,17)18/h2-3H,4H2,1H3.
What are the key properties of 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride?
2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride has a molecular weight of 333.67 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride is sourced from PubChem (CID 43246993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).