C14H20N2O2S — CID 43248092
N-(3-carbamothioylphenyl)-4-propoxybutanamide (PubChem CID 43248092) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-4-propoxybutanamide.
| Compound Name | N-(3-carbamothioylphenyl)-4-propoxybutanamide |
|---|---|
| PubChem CID | 43248092 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(3-carbamothioylphenyl)-4-propoxybutanamide |
| SMILES | CCCOCCCC(=O)Nc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C14H20N2O2S/c1-2-8-18-9-4-7-13(17)16-12-6-3-5-11(10-12)14(15)19/h3,5-6,10H,2,4,7-9H2,1H3,(H2,15,19)(H,16,17) |
| InChIKey | ZDPBWJPOKDIXSO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|