C12H10F5N3 — CID 43248561
2,2,3,3,3-pentafluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine (PubChem CID 43248561) has the molecular formula C12H10F5N3 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 43248561 |
| Molecular Formula | C12H10F5N3 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine |
| SMILES | NC(c1cnn(-c2ccccc2)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F5N3/c13-11(14,12(15,16)17)10(18)8-6-19-20(7-8)9-4-2-1-3-5-9/h1-7,10H,18H2 |
| InChIKey | UXQFMICUWNPUBM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|