C7H2ClF5N4 — CID 43248580
7-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 43248580) has the molecular formula C7H2ClF5N4 and a molecular weight of 272.56 g/mol. Its IUPAC name is 7-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 43248580 |
| Molecular Formula | C7H2ClF5N4 |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 7-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | FC(F)(F)C(F)(F)c1nnc2cc(Cl)ncn12 |
| InChI | InChI=1S/C7H2ClF5N4/c8-3-1-4-15-16-5(17(4)2-14-3)6(9,10)7(11,12)13/h1-2H |
| InChIKey | DIODLPZZUFXZGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|