C14H11ClN2OS — CID 43251027
2-(1,3-benzoxazol-2-ylmethylsulfanyl)-5-chloroaniline (PubChem CID 43251027) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-5-chloroaniline.
| Compound Name | 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-5-chloroaniline |
|---|---|
| PubChem CID | 43251027 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-5-chloroaniline |
| SMILES | Nc1cc(Cl)ccc1SCc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H11ClN2OS/c15-9-5-6-13(10(16)7-9)19-8-14-17-11-3-1-2-4-12(11)18-14/h1-7H,8,16H2 |
| InChIKey | JPARDFYIZNZVSH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|