About 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine
3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 43251183) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| PubChem CID | 43251183 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Cc1ccc(CSc2n[nH]c(N)n2)o1 |
| InChI | InChI=1S/C8H10N4OS/c1-5-2-3-6(13-5)4-14-8-10-7(9)11-12-8/h2-3H,4H2,1H3,(H3,9,10,11,12) |
| InChIKey | SPNGOQDOMSVAAB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (CID 43251183) is 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine is Cc1ccc(CSc2n[nH]c(N)n2)o1.
What is the InChIKey of 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine?
The InChIKey is SPNGOQDOMSVAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-5-2-3-6(13-5)4-14-8-10-7(9)11-12-8/h2-3H,4H2,1H3,(H3,9,10,11,12).
What are the key properties of 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine?
3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine has a molecular weight of 210.26 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methylfuran-2-yl)methylsulfanyl]-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 43251183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).