C13H27N3O — CID 43252178
1-[4-(1-aminopentan-3-yl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 43252178) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-[4-(1-aminopentan-3-yl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(1-aminopentan-3-yl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 43252178 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1-[4-(1-aminopentan-3-yl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(C(CC)CCN)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-3-12(6-7-14)15-8-5-9-16(11-10-15)13(17)4-2/h12H,3-11,14H2,1-2H3 |
| InChIKey | YPAZVKHJRCFPIH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |