About 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide
4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide (PubChem CID 43252361) has the molecular formula C14H32N4O2S
and a molecular weight of 320.50 g/mol. Its IUPAC name is 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide |
| PubChem CID | 43252361 |
| Molecular Formula | C14H32N4O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide |
| SMILES | CCC(CCN)N1CCCN(S(=O)(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C14H32N4O2S/c1-4-14(8-9-15)16-10-7-11-18(13-12-16)21(19,20)17(5-2)6-3/h14H,4-13,15H2,1-3H3 |
| InChIKey | RLZVEKUVLMMRFM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide?
The IUPAC name of 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide (CID 43252361) is 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide.
What is the SMILES notation for 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide?
The canonical SMILES for 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide is CCC(CCN)N1CCCN(S(=O)(=O)N(CC)CC)CC1.
What is the InChIKey of 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide?
The InChIKey is RLZVEKUVLMMRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N4O2S/c1-4-14(8-9-15)16-10-7-11-18(13-12-16)21(19,20)17(5-2)6-3/h14H,4-13,15H2,1-3H3.
What are the key properties of 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide?
4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide has a molecular weight of 320.50 g/mol, XLogP of 0.71, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminopentan-3-yl)-N,N-diethyl-1,4-diazepane-1-sulfonamide is sourced from PubChem (CID 43252361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).