C18H39N3 — CID 43253288
3-(4-octyl-1,4-diazepan-1-yl)pentan-1-amine (PubChem CID 43253288) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is 3-(4-octyl-1,4-diazepan-1-yl)pentan-1-amine.
| Compound Name | 3-(4-octyl-1,4-diazepan-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 43253288 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 3-(4-octyl-1,4-diazepan-1-yl)pentan-1-amine |
| SMILES | CCCCCCCCN1CCCN(C(CC)CCN)CC1 |
| InChI | InChI=1S/C18H39N3/c1-3-5-6-7-8-9-13-20-14-10-15-21(17-16-20)18(4-2)11-12-19/h18H,3-17,19H2,1-2H3 |
| InChIKey | BFOYQXFSWJNDBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|