C9H12Cl2N2O2S — CID 43256853
4-amino-2,6-dichloro-N-propylbenzenesulfonamide (PubChem CID 43256853) has the molecular formula C9H12Cl2N2O2S and a molecular weight of 283.18 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-propylbenzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 43256853 |
| Molecular Formula | C9H12Cl2N2O2S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 4-amino-2,6-dichloro-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N2O2S/c1-2-3-13-16(14,15)9-7(10)4-6(12)5-8(9)11/h4-5,13H,2-3,12H2,1H3 |
| InChIKey | CNQBDJGWKZRQOY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|