C11H16N2O2S — CID 43256969
3-amino-N-cyclopropyl-2,6-dimethylbenzenesulfonamide (PubChem CID 43256969) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-2,6-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-cyclopropyl-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43256969 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-amino-N-cyclopropyl-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(N)c(C)c1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C11H16N2O2S/c1-7-3-6-10(12)8(2)11(7)16(14,15)13-9-4-5-9/h3,6,9,13H,4-5,12H2,1-2H3 |
| InChIKey | SAPGDQDJKIWRMU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|