About 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide
2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide (PubChem CID 43257085) has the molecular formula C8H9Br2N3O3S
and a molecular weight of 387.05 g/mol. Its IUPAC name is 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide |
| PubChem CID | 43257085 |
| Molecular Formula | C8H9Br2N3O3S |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 384.87 |
| IUPAC Name | 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C8H9Br2N3O3S/c9-4-1-5(10)8(6(11)2-4)17(15,16)13-3-7(12)14/h1-2,13H,3,11H2,(H2,12,14) |
| InChIKey | VCGFVZBOLHZREA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide?
The IUPAC name of 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide (CID 43257085) is 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide.
What is the SMILES notation for 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide?
The canonical SMILES for 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide is NC(=O)CNS(=O)(=O)c1c(N)cc(Br)cc1Br.
What is the InChIKey of 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide?
The InChIKey is VCGFVZBOLHZREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br2N3O3S/c9-4-1-5(10)8(6(11)2-4)17(15,16)13-3-7(12)14/h1-2,13H,3,11H2,(H2,12,14).
What are the key properties of 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide?
2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide has a molecular weight of 387.05 g/mol, XLogP of 0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]acetamide is sourced from PubChem (CID 43257085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).