C13H11Br3N2O2S — CID 43258134
4-amino-2,6-dibromo-N-(2-bromo-4-methylphenyl)benzenesulfonamide (PubChem CID 43258134) has the molecular formula C13H11Br3N2O2S and a molecular weight of 499.02 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-(2-bromo-4-methylphenyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-(2-bromo-4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43258134 |
| Molecular Formula | C13H11Br3N2O2S |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 495.81 |
| IUPAC Name | 4-amino-2,6-dibromo-N-(2-bromo-4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(Br)cc(N)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C13H11Br3N2O2S/c1-7-2-3-12(9(14)4-7)18-21(19,20)13-10(15)5-8(17)6-11(13)16/h2-6,18H,17H2,1H3 |
| InChIKey | URRMWWPPNSGAOW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|