C8H7Cl2F3N2O2S — CID 43258401
4-amino-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 43258401) has the molecular formula C8H7Cl2F3N2O2S and a molecular weight of 323.12 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43258401 |
| Molecular Formula | C8H7Cl2F3N2O2S |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)NCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2F3N2O2S/c9-5-1-4(14)2-6(10)7(5)18(16,17)15-3-8(11,12)13/h1-2,15H,3,14H2 |
| InChIKey | FBHQGXPARMILQG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|