C13H20N4O2 — CID 43259605
1-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]piperidine-4-carboxamide (PubChem CID 43259605) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43259605 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[2-(5-amino-2-oxo-1-pyridinyl)ethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCn2cc(N)ccc2=O)CC1 |
| InChI | InChI=1S/C13H20N4O2/c14-11-1-2-12(18)17(9-11)8-7-16-5-3-10(4-6-16)13(15)19/h1-2,9-10H,3-8,14H2,(H2,15,19) |
| InChIKey | IDHGVDYCGAFFJE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |