About 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one
5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one (PubChem CID 43260392) has the molecular formula C13H12F2N2OS
and a molecular weight of 282.32 g/mol. Its IUPAC name is 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one |
| PubChem CID | 43260392 |
| Molecular Formula | C13H12F2N2OS |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one |
| SMILES | Nc1ccc(=O)n(CCSc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H12F2N2OS/c14-11-3-2-10(7-12(11)15)19-6-5-17-8-9(16)1-4-13(17)18/h1-4,7-8H,5-6,16H2 |
| InChIKey | NGOLIGREZHMDRV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one?
The IUPAC name of 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one (CID 43260392) is 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one.
What is the SMILES notation for 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one?
The canonical SMILES for 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one is Nc1ccc(=O)n(CCSc2ccc(F)c(F)c2)c1.
What is the InChIKey of 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one?
The InChIKey is NGOLIGREZHMDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2OS/c14-11-3-2-10(7-12(11)15)19-6-5-17-8-9(16)1-4-13(17)18/h1-4,7-8H,5-6,16H2.
What are the key properties of 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one?
5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one has a molecular weight of 282.32 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-[2-(3,4-difluorophenyl)sulfanylethyl]pyridin-2-one is sourced from PubChem (CID 43260392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).