C13H12F2N2OS — CID 43260404
5-amino-1-[2-(2,4-difluorophenyl)sulfanylethyl]pyridin-2-one (PubChem CID 43260404) has the molecular formula C13H12F2N2OS and a molecular weight of 282.31 g/mol. Its IUPAC name is 5-amino-1-[2-(2,4-difluorophenyl)sulfanylethyl]pyridin-2-one.
| Compound Name | 5-amino-1-[2-(2,4-difluorophenyl)sulfanylethyl]pyridin-2-one |
|---|---|
| PubChem CID | 43260404 |
| Molecular Formula | C13H12F2N2OS |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-amino-1-[2-(2,4-difluorophenyl)sulfanylethyl]pyridin-2-one |
| SMILES | Nc1ccc(=O)n(CCSc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H12F2N2OS/c14-9-1-3-12(11(15)7-9)19-6-5-17-8-10(16)2-4-13(17)18/h1-4,7-8H,5-6,16H2 |
| InChIKey | CTUZGPGLHRVMDE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |