About 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine
2-chloro-6-(1,2,4-triazol-1-yl)pyrazine (PubChem CID 43260428) has the molecular formula C6H4ClN5
and a molecular weight of 181.59 g/mol. Its IUPAC name is 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine.
Molecular Properties
| Compound Name | 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine |
| PubChem CID | 43260428 |
| Molecular Formula | C6H4ClN5 |
| Molecular Weight | 181.59 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine |
| SMILES | Clc1cncc(-n2cncn2)n1 |
| InChI | InChI=1S/C6H4ClN5/c7-5-1-8-2-6(11-5)12-4-9-3-10-12/h1-4H |
| InChIKey | FWRVCHWLTLLRDR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine?
The IUPAC name of 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine (CID 43260428) is 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine.
What is the SMILES notation for 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine?
The canonical SMILES for 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine is Clc1cncc(-n2cncn2)n1.
What is the InChIKey of 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine?
The InChIKey is FWRVCHWLTLLRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN5/c7-5-1-8-2-6(11-5)12-4-9-3-10-12/h1-4H.
What are the key properties of 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine?
2-chloro-6-(1,2,4-triazol-1-yl)pyrazine has a molecular weight of 181.59 g/mol, XLogP of 0.71, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(1,2,4-triazol-1-yl)pyrazine is sourced from PubChem (CID 43260428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).