About 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine
6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine (PubChem CID 43260475) has the molecular formula C11H5Cl3N2O2S
and a molecular weight of 335.60 g/mol. Its IUPAC name is 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine.
Molecular Properties
| Compound Name | 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine |
| PubChem CID | 43260475 |
| Molecular Formula | C11H5Cl3N2O2S |
| Molecular Weight | 335.60 g/mol |
| Exact Mass | 333.91 |
| IUPAC Name | 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H5Cl3N2O2S/c12-6-1-2-7(13)9(5-6)19-11-8(16(17)18)3-4-10(14)15-11/h1-5H |
| InChIKey | CAIVIOPHNUTUGL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine?
The IUPAC name of 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine (CID 43260475) is 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine.
What is the SMILES notation for 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine?
The canonical SMILES for 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine is O=[N+]([O-])c1ccc(Cl)nc1Sc1cc(Cl)ccc1Cl.
What is the InChIKey of 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine?
The InChIKey is CAIVIOPHNUTUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl3N2O2S/c12-6-1-2-7(13)9(5-6)19-11-8(16(17)18)3-4-10(14)15-11/h1-5H.
What are the key properties of 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine?
6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine has a molecular weight of 335.60 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2,5-dichlorophenyl)sulfanyl-3-nitropyridine is sourced from PubChem (CID 43260475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).