C14H14F3N3O — CID 43261407
6-propoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine (PubChem CID 43261407) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 6-propoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine.
| Compound Name | 6-propoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 43261407 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 6-propoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine |
| SMILES | CCCOc1nc(Nc2ccc(F)c(F)c2F)ccc1N |
| InChI | InChI=1S/C14H14F3N3O/c1-2-7-21-14-9(18)4-6-11(20-14)19-10-5-3-8(15)12(16)13(10)17/h3-6H,2,7,18H2,1H3,(H,19,20) |
| InChIKey | KYJCRJPVXMERDV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|