C13H12F3N3O — CID 43261409
6-ethoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine (PubChem CID 43261409) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 6-ethoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine.
| Compound Name | 6-ethoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 43261409 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 6-ethoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine |
| SMILES | CCOc1nc(Nc2ccc(F)c(F)c2F)ccc1N |
| InChI | InChI=1S/C13H12F3N3O/c1-2-20-13-8(17)4-6-10(19-13)18-9-5-3-7(14)11(15)12(9)16/h3-6H,2,17H2,1H3,(H,18,19) |
| InChIKey | CBTBBSQWIWQDQY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|