C12H10F3N3O — CID 43261410
6-methoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine (PubChem CID 43261410) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is 6-methoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine.
| Compound Name | 6-methoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 43261410 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-methoxy-2-N-(2,3,4-trifluorophenyl)pyridine-2,5-diamine |
| SMILES | COc1nc(Nc2ccc(F)c(F)c2F)ccc1N |
| InChI | InChI=1S/C12H10F3N3O/c1-19-12-7(16)3-5-9(18-12)17-8-4-2-6(13)10(14)11(8)15/h2-5H,16H2,1H3,(H,17,18) |
| InChIKey | UOGMYLIYXVAWEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|