C16H15N3O2 — CID 43262342
3-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]oxy]benzonitrile (PubChem CID 43262342) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]oxy]benzonitrile.
| Compound Name | 3-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]oxy]benzonitrile |
|---|---|
| PubChem CID | 43262342 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]oxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2ccc(N)c(OCC3CC3)n2)c1 |
| InChI | InChI=1S/C16H15N3O2/c17-9-12-2-1-3-13(8-12)21-15-7-6-14(18)16(19-15)20-10-11-4-5-11/h1-3,6-8,11H,4-5,10,18H2 |
| InChIKey | SLEGZMYYTYQKPY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |