About N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide
N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 43263710) has the molecular formula C8H15N3O2S
and a molecular weight of 217.29 g/mol. Its IUPAC name is N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 43263710 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C8H15N3O2S/c1-5-11(4)14(12,13)8-6(2)9-10-7(8)3/h5H2,1-4H3,(H,9,10) |
| InChIKey | UQRNEGSLXZOVMP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide (CID 43263710) is N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide is CCN(C)S(=O)(=O)c1c(C)n[nH]c1C.
What is the InChIKey of N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide?
The InChIKey is UQRNEGSLXZOVMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2S/c1-5-11(4)14(12,13)8-6(2)9-10-7(8)3/h5H2,1-4H3,(H,9,10).
What are the key properties of N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide?
N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide has a molecular weight of 217.29 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 43263710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).