N-cyclopropyl-N-ethylsulfamoyl chloride

C5H10ClNO2S — CID 43264097

IUPACN-cyclopropyl-N-ethylsulfamoyl chloride
SMILESCCN(C1CC1)S(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO2S/c1-2-7(5-3-4-5)10(6,8)9/h5H,2-4H2,1H3
InChIKeyNRWMZTKUHUMKJJ-UHFFFAOYSA-N
MW183.66 g/mol
LogP0.95
Rot. Bonds3

About N-cyclopropyl-N-ethylsulfamoyl chloride

N-cyclopropyl-N-ethylsulfamoyl chloride (PubChem CID 43264097) has the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. Its IUPAC name is N-cyclopropyl-N-ethylsulfamoyl chloride.

Molecular Properties

Compound NameN-cyclopropyl-N-ethylsulfamoyl chloride
PubChem CID43264097
Molecular FormulaC5H10ClNO2S
Molecular Weight183.66 g/mol
Exact Mass183.01
IUPAC NameN-cyclopropyl-N-ethylsulfamoyl chloride
SMILESCCN(C1CC1)S(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO2S/c1-2-7(5-3-4-5)10(6,8)9/h5H,2-4H2,1H3
InChIKeyNRWMZTKUHUMKJJ-UHFFFAOYSA-N
XLogP0.95
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.66
LogP ≤ 50.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-cyclopropyl-N-ethylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclopropyl-N-ethylsulfamoyl chloride?
The IUPAC name of N-cyclopropyl-N-ethylsulfamoyl chloride (CID 43264097) is N-cyclopropyl-N-ethylsulfamoyl chloride.
What is the SMILES notation for N-cyclopropyl-N-ethylsulfamoyl chloride?
The canonical SMILES for N-cyclopropyl-N-ethylsulfamoyl chloride is CCN(C1CC1)S(=O)(=O)Cl.
What is the InChIKey of N-cyclopropyl-N-ethylsulfamoyl chloride?
The InChIKey is NRWMZTKUHUMKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO2S/c1-2-7(5-3-4-5)10(6,8)9/h5H,2-4H2,1H3.
What are the key properties of N-cyclopropyl-N-ethylsulfamoyl chloride?
N-cyclopropyl-N-ethylsulfamoyl chloride has a molecular weight of 183.66 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-ethylsulfamoyl chloride is sourced from PubChem (CID 43264097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).