About 4-butoxybutanethioamide
4-butoxybutanethioamide (PubChem CID 43267710) has the molecular formula C8H17NOS
and a molecular weight of 175.30 g/mol. Its IUPAC name is 4-butoxybutanethioamide.
Molecular Properties
| Compound Name | 4-butoxybutanethioamide |
| PubChem CID | 43267710 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-butoxybutanethioamide |
| SMILES | CCCCOCCCC(N)=S |
| InChI | InChI=1S/C8H17NOS/c1-2-3-6-10-7-4-5-8(9)11/h2-7H2,1H3,(H2,9,11) |
| InChIKey | INGLTDKICDHITN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxybutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxybutanethioamide?
The IUPAC name of 4-butoxybutanethioamide (CID 43267710) is 4-butoxybutanethioamide.
What is the SMILES notation for 4-butoxybutanethioamide?
The canonical SMILES for 4-butoxybutanethioamide is CCCCOCCCC(N)=S.
What is the InChIKey of 4-butoxybutanethioamide?
The InChIKey is INGLTDKICDHITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOS/c1-2-3-6-10-7-4-5-8(9)11/h2-7H2,1H3,(H2,9,11).
What are the key properties of 4-butoxybutanethioamide?
4-butoxybutanethioamide has a molecular weight of 175.30 g/mol, XLogP of 1.87, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxybutanethioamide is sourced from PubChem (CID 43267710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).