About 3-butoxypropanimidamide
3-butoxypropanimidamide (PubChem CID 43267741) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 3-butoxypropanimidamide.
Molecular Properties
| Compound Name | 3-butoxypropanimidamide |
| PubChem CID | 43267741 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 3-butoxypropanimidamide |
| SMILES | [H]/N=C(\N)CCOCCCC |
| InChI | InChI=1S/C7H16N2O/c1-2-3-5-10-6-4-7(8)9/h2-6H2,1H3,(H3,8,9) |
| InChIKey | QSERMXJFBXZUBT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxypropanimidamide?
The IUPAC name of 3-butoxypropanimidamide (CID 43267741) is 3-butoxypropanimidamide.
What is the SMILES notation for 3-butoxypropanimidamide?
The canonical SMILES for 3-butoxypropanimidamide is [H]/N=C(\N)CCOCCCC.
What is the InChIKey of 3-butoxypropanimidamide?
The InChIKey is QSERMXJFBXZUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-2-3-5-10-6-4-7(8)9/h2-6H2,1H3,(H3,8,9).
What are the key properties of 3-butoxypropanimidamide?
3-butoxypropanimidamide has a molecular weight of 144.22 g/mol, XLogP of 1.13, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxypropanimidamide is sourced from PubChem (CID 43267741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).