C15H23N3O — CID 43270011
N-(2-aminophenyl)-2-[cyclopropyl(propyl)amino]propanamide (PubChem CID 43270011) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-[cyclopropyl(propyl)amino]propanamide.
| Compound Name | N-(2-aminophenyl)-2-[cyclopropyl(propyl)amino]propanamide |
|---|---|
| PubChem CID | 43270011 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-(2-aminophenyl)-2-[cyclopropyl(propyl)amino]propanamide |
| SMILES | CCCN(C1CC1)C(C)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C15H23N3O/c1-3-10-18(12-8-9-12)11(2)15(19)17-14-7-5-4-6-13(14)16/h4-7,11-12H,3,8-10,16H2,1-2H3,(H,17,19) |
| InChIKey | QDOSYAVDKQQSNR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|