C14H23N3O — CID 43270832
N-(4-amino-2-methylphenyl)-3-[methyl(propyl)amino]propanamide (PubChem CID 43270832) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(4-amino-2-methylphenyl)-3-[methyl(propyl)amino]propanamide.
| Compound Name | N-(4-amino-2-methylphenyl)-3-[methyl(propyl)amino]propanamide |
|---|---|
| PubChem CID | 43270832 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(4-amino-2-methylphenyl)-3-[methyl(propyl)amino]propanamide |
| SMILES | CCCN(C)CCC(=O)Nc1ccc(N)cc1C |
| InChI | InChI=1S/C14H23N3O/c1-4-8-17(3)9-7-14(18)16-13-6-5-12(15)10-11(13)2/h5-6,10H,4,7-9,15H2,1-3H3,(H,16,18) |
| InChIKey | BSOGGOJPEDJLKX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|